About butanoylazanide;yttrium(3+)
butanoylazanide;yttrium(3+) (PubChem CID 23539854) has the molecular formula C8H16N2O2Y+
and a molecular weight of 261.13 g/mol. Its IUPAC name is butanoylazanide;yttrium(3+).
Molecular Properties
| Compound Name | butanoylazanide;yttrium(3+) |
| PubChem CID | 23539854 |
| Molecular Formula | C8H16N2O2Y+ |
| Molecular Weight | 261.13 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | butanoylazanide;yttrium(3+) |
| SMILES | CCCC([NH-])=O.CCCC([NH-])=O.[Y+3] |
| InChI | InChI=1S/2C4H9NO.Y/c2*1-2-3-4(5)6;/h2*2-3H2,1H3,(H2,5,6);/q;;+3/p-2 |
| InChIKey | FCGBNSPILFLONY-UHFFFAOYSA-L |
| XLogP | 2.73 |
| TPSA | 81.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.13 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butanoylazanide;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoylazanide;yttrium(3+)?
The IUPAC name of butanoylazanide;yttrium(3+) (CID 23539854) is butanoylazanide;yttrium(3+).
What is the SMILES notation for butanoylazanide;yttrium(3+)?
The canonical SMILES for butanoylazanide;yttrium(3+) is CCCC([NH-])=O.CCCC([NH-])=O.[Y+3].
What is the InChIKey of butanoylazanide;yttrium(3+)?
The InChIKey is FCGBNSPILFLONY-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H9NO.Y/c2*1-2-3-4(5)6;/h2*2-3H2,1H3,(H2,5,6);/q;;+3/p-2.
What are the key properties of butanoylazanide;yttrium(3+)?
butanoylazanide;yttrium(3+) has a molecular weight of 261.13 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanoylazanide;yttrium(3+) is sourced from PubChem (CID 23539854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).