About propanoylazanide;terbium
propanoylazanide;terbium (PubChem CID 87733226) has the molecular formula C3H6NOTb-
and a molecular weight of 231.01 g/mol. Its IUPAC name is propanoylazanide;terbium.
Molecular Properties
| Compound Name | propanoylazanide;terbium |
| PubChem CID | 87733226 |
| Molecular Formula | C3H6NOTb- |
| Molecular Weight | 231.01 g/mol |
| Exact Mass | 230.97 |
| IUPAC Name | propanoylazanide;terbium |
| SMILES | CCC([NH-])=O.[Tb] |
| InChI | InChI=1S/C3H7NO.Tb/c1-2-3(4)5;/h2H2,1H3,(H2,4,5);/p-1 |
| InChIKey | CVJJPIMUQKFHFX-UHFFFAOYSA-M |
| XLogP | 0.98 |
| TPSA | 40.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.01 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propanoylazanide;terbium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoylazanide;terbium?
The IUPAC name of propanoylazanide;terbium (CID 87733226) is propanoylazanide;terbium.
What is the SMILES notation for propanoylazanide;terbium?
The canonical SMILES for propanoylazanide;terbium is CCC([NH-])=O.[Tb].
What is the InChIKey of propanoylazanide;terbium?
The InChIKey is CVJJPIMUQKFHFX-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H7NO.Tb/c1-2-3(4)5;/h2H2,1H3,(H2,4,5);/p-1.
What are the key properties of propanoylazanide;terbium?
propanoylazanide;terbium has a molecular weight of 231.01 g/mol, XLogP of 0.98, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propanoylazanide;terbium is sourced from PubChem (CID 87733226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).