C11H22N2O — CID 173299225
2-[(5-amino-2,6-dimethylhept-4-en-3-ylidene)amino]ethanol (PubChem CID 173299225) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-[(5-amino-2,6-dimethylhept-4-en-3-ylidene)amino]ethanol.
| Compound Name | 2-[(5-amino-2,6-dimethylhept-4-en-3-ylidene)amino]ethanol |
|---|---|
| PubChem CID | 173299225 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 2-[(5-amino-2,6-dimethylhept-4-en-3-ylidene)amino]ethanol |
| SMILES | CC(C)C(N)=C/C(=N/CCO)C(C)C |
| InChI | InChI=1S/C11H22N2O/c1-8(2)10(12)7-11(9(3)4)13-5-6-14/h7-9,14H,5-6,12H2,1-4H3/b10-7?,13-11- |
| InChIKey | WQWQSLRCRNWCDZ-VUXHJTBKSA-N |
| XLogP | 1.57 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|