About N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide
N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide (PubChem CID 171645597) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide.
Molecular Properties
| Compound Name | N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide |
| PubChem CID | 171645597 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide |
| SMILES | CC(C)(C)/C(N)=C/C(N)=N/C=O |
| InChI | InChI=1S/C8H15N3O/c1-8(2,3)6(9)4-7(10)11-5-12/h4-5H,9H2,1-3H3,(H2,10,11,12)/b6-4- |
| InChIKey | SYOFXJBCLDIYSR-XQRVVYSFSA-N |
| XLogP | 0.39 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide?
The IUPAC name of N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide (CID 171645597) is N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide.
What is the SMILES notation for N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide?
The canonical SMILES for N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide is CC(C)(C)/C(N)=C/C(N)=N/C=O.
What is the InChIKey of N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide?
The InChIKey is SYOFXJBCLDIYSR-XQRVVYSFSA-N. The full InChI is InChI=1S/C8H15N3O/c1-8(2,3)6(9)4-7(10)11-5-12/h4-5H,9H2,1-3H3,(H2,10,11,12)/b6-4-.
What are the key properties of N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide?
N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide has a molecular weight of 169.23 g/mol, XLogP of 0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide is sourced from PubChem (CID 171645597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).