C8H15N3O — CID 171645597
N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide (PubChem CID 171645597) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide.
| Compound Name | N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide |
|---|---|
| PubChem CID | 171645597 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | N-[(Z)-1,3-diamino-4,4-dimethylpent-2-enylidene]formamide |
| SMILES | CC(C)(C)/C(N)=C/C(N)=N/C=O |
| InChI | InChI=1S/C8H15N3O/c1-8(2,3)6(9)4-7(10)11-5-12/h4-5H,9H2,1-3H3,(H2,10,11,12)/b6-4- |
| InChIKey | SYOFXJBCLDIYSR-XQRVVYSFSA-N |
| XLogP | 0.39 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|