C15H28ClN — CID 135291363
(3Z,5Z)-7-chloro-2,2,6-trimethyl-5-propan-2-ylnona-3,5-dien-3-amine (PubChem CID 135291363) has the molecular formula C15H28ClN and a molecular weight of 257.85 g/mol. Its IUPAC name is (3Z,5Z)-7-chloro-2,2,6-trimethyl-5-propan-2-ylnona-3,5-dien-3-amine.
| Compound Name | (3Z,5Z)-7-chloro-2,2,6-trimethyl-5-propan-2-ylnona-3,5-dien-3-amine |
|---|---|
| PubChem CID | 135291363 |
| Molecular Formula | C15H28ClN |
| Molecular Weight | 257.85 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | (3Z,5Z)-7-chloro-2,2,6-trimethyl-5-propan-2-ylnona-3,5-dien-3-amine |
| SMILES | CCC(Cl)/C(C)=C(\C=C(/N)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C15H28ClN/c1-8-13(16)11(4)12(10(2)3)9-14(17)15(5,6)7/h9-10,13H,8,17H2,1-7H3/b12-11+,14-9- |
| InChIKey | SFAZVTSHWKJGHG-BVIMHVQXSA-N |
| XLogP | 4.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.85 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|