C14H29N — CID 166922299
(Z)-7-ethyl-2,2-dimethyldec-3-en-3-amine (PubChem CID 166922299) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is (Z)-7-ethyl-2,2-dimethyldec-3-en-3-amine.
| Compound Name | (Z)-7-ethyl-2,2-dimethyldec-3-en-3-amine |
|---|---|
| PubChem CID | 166922299 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | (Z)-7-ethyl-2,2-dimethyldec-3-en-3-amine |
| SMILES | CCCC(CC)CC/C=C(\N)C(C)(C)C |
| InChI | InChI=1S/C14H29N/c1-6-9-12(7-2)10-8-11-13(15)14(3,4)5/h11-12H,6-10,15H2,1-5H3/b13-11- |
| InChIKey | HMBFMWJXXOYSNK-QBFSEMIESA-N |
| XLogP | 4.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |