C8H18N2O — CID 155659561
5,5-diamino-2-propylpent-4-en-1-ol (PubChem CID 155659561) has the molecular formula C8H18N2O and a molecular weight of 158.25 g/mol. Its IUPAC name is 5,5-diamino-2-propylpent-4-en-1-ol.
| Compound Name | 5,5-diamino-2-propylpent-4-en-1-ol |
|---|---|
| PubChem CID | 155659561 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 5,5-diamino-2-propylpent-4-en-1-ol |
| SMILES | CCCC(CO)CC=C(N)N |
| InChI | InChI=1S/C8H18N2O/c1-2-3-7(6-11)4-5-8(9)10/h5,7,11H,2-4,6,9-10H2,1H3 |
| InChIKey | XZJYWLXEMAUSMZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |