About (2S)-2-propylheptane-1,7-diol
(2S)-2-propylheptane-1,7-diol (PubChem CID 118890038) has the molecular formula C10H22O2
and a molecular weight of 174.28 g/mol. Its IUPAC name is (2S)-2-propylheptane-1,7-diol.
Molecular Properties
| Compound Name | (2S)-2-propylheptane-1,7-diol |
| PubChem CID | 118890038 |
| Molecular Formula | C10H22O2 |
| Molecular Weight | 174.28 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | (2S)-2-propylheptane-1,7-diol |
| SMILES | CCC[C@H](CO)CCCCCO |
| InChI | InChI=1S/C10H22O2/c1-2-6-10(9-12)7-4-3-5-8-11/h10-12H,2-9H2,1H3/t10-/m0/s1 |
| InChIKey | LUBVMSJAIONYPI-JTQLQIEISA-N |
| XLogP | 1.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-propylheptane-1,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-propylheptane-1,7-diol?
The IUPAC name of (2S)-2-propylheptane-1,7-diol (CID 118890038) is (2S)-2-propylheptane-1,7-diol.
What is the SMILES notation for (2S)-2-propylheptane-1,7-diol?
The canonical SMILES for (2S)-2-propylheptane-1,7-diol is CCC[C@H](CO)CCCCCO.
What is the InChIKey of (2S)-2-propylheptane-1,7-diol?
The InChIKey is LUBVMSJAIONYPI-JTQLQIEISA-N. The full InChI is InChI=1S/C10H22O2/c1-2-6-10(9-12)7-4-3-5-8-11/h10-12H,2-9H2,1H3/t10-/m0/s1.
What are the key properties of (2S)-2-propylheptane-1,7-diol?
(2S)-2-propylheptane-1,7-diol has a molecular weight of 174.28 g/mol, XLogP of 1.95, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-propylheptane-1,7-diol is sourced from PubChem (CID 118890038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).