C8H13NO2 — CID 170266164
(E)-3-amino-6-methylhept-3-ene-2,5-dione (PubChem CID 170266164) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (E)-3-amino-6-methylhept-3-ene-2,5-dione.
| Compound Name | (E)-3-amino-6-methylhept-3-ene-2,5-dione |
|---|---|
| PubChem CID | 170266164 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (E)-3-amino-6-methylhept-3-ene-2,5-dione |
| SMILES | CC(=O)/C(N)=C\C(=O)C(C)C |
| InChI | InChI=1S/C8H13NO2/c1-5(2)8(11)4-7(9)6(3)10/h4-5H,9H2,1-3H3/b7-4+ |
| InChIKey | LSLZLEFYDBQNML-QPJJXVBHSA-N |
| XLogP | 0.64 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|