C9H15O2- — CID 99939056
2,6-dimethyl-5-oxohept-3-en-3-olate (PubChem CID 99939056) has the molecular formula C9H15O2- and a molecular weight of 155.22 g/mol. Its IUPAC name is 2,6-dimethyl-5-oxohept-3-en-3-olate.
| Compound Name | 2,6-dimethyl-5-oxohept-3-en-3-olate |
|---|---|
| PubChem CID | 99939056 |
| Molecular Formula | C9H15O2- |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 2,6-dimethyl-5-oxohept-3-en-3-olate |
| SMILES | CC(C)C(=O)C=C([O-])C(C)C |
| InChI | InChI=1S/C9H16O2/c1-6(2)8(10)5-9(11)7(3)4/h5-7,10H,1-4H3/p-1 |
| InChIKey | JIYKPNNTWHWONK-UHFFFAOYSA-M |
| XLogP | 1.11 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|