C10H18O3 — CID 15830314
(Z)-5-hydroxy-6-methoxy-2,6-dimethylhept-4-en-3-one (PubChem CID 15830314) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (Z)-5-hydroxy-6-methoxy-2,6-dimethylhept-4-en-3-one.
| Compound Name | (Z)-5-hydroxy-6-methoxy-2,6-dimethylhept-4-en-3-one |
|---|---|
| PubChem CID | 15830314 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (Z)-5-hydroxy-6-methoxy-2,6-dimethylhept-4-en-3-one |
| SMILES | COC(C)(C)/C(O)=C/C(=O)C(C)C |
| InChI | InChI=1S/C10H18O3/c1-7(2)8(11)6-9(12)10(3,4)13-5/h6-7,12H,1-5H3/b9-6- |
| InChIKey | XWUBQHTYUUWTKE-TWGQIWQCSA-N |
| XLogP | 2.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|