C11H18O3 — CID 58193333
(Z)-4-methoxy-2,7-dimethyloct-4-ene-3,6-dione (PubChem CID 58193333) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (Z)-4-methoxy-2,7-dimethyloct-4-ene-3,6-dione.
| Compound Name | (Z)-4-methoxy-2,7-dimethyloct-4-ene-3,6-dione |
|---|---|
| PubChem CID | 58193333 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (Z)-4-methoxy-2,7-dimethyloct-4-ene-3,6-dione |
| SMILES | CO/C(=C\C(=O)C(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C11H18O3/c1-7(2)9(12)6-10(14-5)11(13)8(3)4/h6-8H,1-5H3/b10-6- |
| InChIKey | STBPWAHWEAMFHV-POHAHGRESA-N |
| XLogP | 1.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|