C6H9ClO — CID 102248178
(E)-1-chloro-1,2-dideuterio-4-methylpent-1-en-3-one (PubChem CID 102248178) has the molecular formula C6H9ClO and a molecular weight of 134.60 g/mol. Its IUPAC name is (E)-1-chloro-1,2-dideuterio-4-methylpent-1-en-3-one.
| Compound Name | (E)-1-chloro-1,2-dideuterio-4-methylpent-1-en-3-one |
|---|---|
| PubChem CID | 102248178 |
| Molecular Formula | C6H9ClO |
| Molecular Weight | 134.60 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | (E)-1-chloro-1,2-dideuterio-4-methylpent-1-en-3-one |
| SMILES | [2H]/C(Cl)=C(/[2H])C(=O)C(C)C |
| InChI | InChI=1S/C6H9ClO/c1-5(2)6(8)3-4-7/h3-5H,1-2H3/b4-3+/i3D,4D |
| InChIKey | YCDOHSUMKPOXSR-SWIHUIHJSA-N |
| XLogP | 1.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.60 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|