C10H16OS — CID 101185151
(4Z)-2,6-dimethyl-5-methylsulfanylhepta-4,6-dien-3-one (PubChem CID 101185151) has the molecular formula C10H16OS and a molecular weight of 184.30 g/mol. Its IUPAC name is (4Z)-2,6-dimethyl-5-methylsulfanylhepta-4,6-dien-3-one.
| Compound Name | (4Z)-2,6-dimethyl-5-methylsulfanylhepta-4,6-dien-3-one |
|---|---|
| PubChem CID | 101185151 |
| Molecular Formula | C10H16OS |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | (4Z)-2,6-dimethyl-5-methylsulfanylhepta-4,6-dien-3-one |
| SMILES | C=C(C)/C(=C/C(=O)C(C)C)SC |
| InChI | InChI=1S/C10H16OS/c1-7(2)9(11)6-10(12-5)8(3)4/h6-7H,3H2,1-2,4-5H3/b10-6- |
| InChIKey | ZIPQCJXIFJFVCC-POHAHGRESA-N |
| XLogP | 3.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|