C11H16OS — CID 144804148
(3E)-6-methyl-2,5-dimethylidene-3-methylsulfanylhepta-3,6-dien-1-ol (PubChem CID 144804148) has the molecular formula C11H16OS and a molecular weight of 196.31 g/mol. Its IUPAC name is (3E)-6-methyl-2,5-dimethylidene-3-methylsulfanylhepta-3,6-dien-1-ol.
| Compound Name | (3E)-6-methyl-2,5-dimethylidene-3-methylsulfanylhepta-3,6-dien-1-ol |
|---|---|
| PubChem CID | 144804148 |
| Molecular Formula | C11H16OS |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (3E)-6-methyl-2,5-dimethylidene-3-methylsulfanylhepta-3,6-dien-1-ol |
| SMILES | C=C(C)C(=C)/C=C(/SC)C(=C)CO |
| InChI | InChI=1S/C11H16OS/c1-8(2)9(3)6-11(13-5)10(4)7-12/h6,12H,1,3-4,7H2,2,5H3/b11-6+ |
| InChIKey | OQDSCRPIHXNPIM-IZZDOVSWSA-N |
| XLogP | 2.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|