C9H19N — CID 156721750
2,4-dimethylpent-1-en-3-imine;ethane (PubChem CID 156721750) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is 2,4-dimethylpent-1-en-3-imine;ethane.
| Compound Name | 2,4-dimethylpent-1-en-3-imine;ethane |
|---|---|
| PubChem CID | 156721750 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 2,4-dimethylpent-1-en-3-imine;ethane |
| SMILES | CC.[H]/N=C(\C(=C)C)C(C)C |
| InChI | InChI=1S/C7H13N.C2H6/c1-5(2)7(8)6(3)4;1-2/h6,8H,1H2,2-4H3;1-2H3/b8-7+; |
| InChIKey | VOPZLNYPFWXFQY-USRGLUTNSA-N |
| XLogP | 3.26 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|