About 2-imino-3-methylbutanoyl chloride
2-imino-3-methylbutanoyl chloride (PubChem CID 142079723) has the molecular formula C5H8ClNO
and a molecular weight of 133.58 g/mol. Its IUPAC name is 2-imino-3-methylbutanoyl chloride.
Molecular Properties
| Compound Name | 2-imino-3-methylbutanoyl chloride |
| PubChem CID | 142079723 |
| Molecular Formula | C5H8ClNO |
| Molecular Weight | 133.58 g/mol |
| Exact Mass | 133.03 |
| IUPAC Name | 2-imino-3-methylbutanoyl chloride |
| SMILES | [H]/N=C(\C(=O)Cl)C(C)C |
| InChI | InChI=1S/C5H8ClNO/c1-3(2)4(7)5(6)8/h3,7H,1-2H3/b7-4- |
| InChIKey | LABJHBDODCEHTC-DAXSKMNVSA-N |
| XLogP | 1.43 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.58 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-3-methylbutanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-3-methylbutanoyl chloride?
The IUPAC name of 2-imino-3-methylbutanoyl chloride (CID 142079723) is 2-imino-3-methylbutanoyl chloride.
What is the SMILES notation for 2-imino-3-methylbutanoyl chloride?
The canonical SMILES for 2-imino-3-methylbutanoyl chloride is [H]/N=C(\C(=O)Cl)C(C)C.
What is the InChIKey of 2-imino-3-methylbutanoyl chloride?
The InChIKey is LABJHBDODCEHTC-DAXSKMNVSA-N. The full InChI is InChI=1S/C5H8ClNO/c1-3(2)4(7)5(6)8/h3,7H,1-2H3/b7-4-.
What are the key properties of 2-imino-3-methylbutanoyl chloride?
2-imino-3-methylbutanoyl chloride has a molecular weight of 133.58 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-3-methylbutanoyl chloride is sourced from PubChem (CID 142079723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).