C15H25NO2 — CID 163687939
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl 2-imino-3-methylbutanoate (PubChem CID 163687939) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl 2-imino-3-methylbutanoate.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl 2-imino-3-methylbutanoate |
|---|---|
| PubChem CID | 163687939 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl 2-imino-3-methylbutanoate |
| SMILES | [H]/N=C(/C(=O)OC1CCCC2CCCCC21)C(C)C |
| InChI | InChI=1S/C15H25NO2/c1-10(2)14(16)15(17)18-13-9-5-7-11-6-3-4-8-12(11)13/h10-13,16H,3-9H2,1-2H3/b16-14+ |
| InChIKey | JQMGWYHYPVLYHM-JQIJEIRASA-N |
| XLogP | 3.56 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|