About 4-chloro-3,5-diiminohexan-2-one
4-chloro-3,5-diiminohexan-2-one (PubChem CID 123325188) has the molecular formula C6H9ClN2O
and a molecular weight of 160.60 g/mol. Its IUPAC name is 4-chloro-3,5-diiminohexan-2-one.
Molecular Properties
| Compound Name | 4-chloro-3,5-diiminohexan-2-one |
| PubChem CID | 123325188 |
| Molecular Formula | C6H9ClN2O |
| Molecular Weight | 160.60 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | 4-chloro-3,5-diiminohexan-2-one |
| SMILES | [H]/N=C(\C)C(Cl)/C(=N/[H])C(C)=O |
| InChI | InChI=1S/C6H9ClN2O/c1-3(8)5(7)6(9)4(2)10/h5,8-9H,1-2H3/b8-3+,9-6+ |
| InChIKey | CLPFTOXFLDDCGW-WKALFTOFSA-N |
| XLogP | 1.24 |
| TPSA | 64.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.60 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3,5-diiminohexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3,5-diiminohexan-2-one?
The IUPAC name of 4-chloro-3,5-diiminohexan-2-one (CID 123325188) is 4-chloro-3,5-diiminohexan-2-one.
What is the SMILES notation for 4-chloro-3,5-diiminohexan-2-one?
The canonical SMILES for 4-chloro-3,5-diiminohexan-2-one is [H]/N=C(\C)C(Cl)/C(=N/[H])C(C)=O.
What is the InChIKey of 4-chloro-3,5-diiminohexan-2-one?
The InChIKey is CLPFTOXFLDDCGW-WKALFTOFSA-N. The full InChI is InChI=1S/C6H9ClN2O/c1-3(8)5(7)6(9)4(2)10/h5,8-9H,1-2H3/b8-3+,9-6+.
What are the key properties of 4-chloro-3,5-diiminohexan-2-one?
4-chloro-3,5-diiminohexan-2-one has a molecular weight of 160.60 g/mol, XLogP of 1.24, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3,5-diiminohexan-2-one is sourced from PubChem (CID 123325188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).