About 2-amino-3-iminobutanoyl chloride;hydrochloride
2-amino-3-iminobutanoyl chloride;hydrochloride (PubChem CID 88808185) has the molecular formula C4H8Cl2N2O
and a molecular weight of 171.03 g/mol. Its IUPAC name is 2-amino-3-iminobutanoyl chloride;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-3-iminobutanoyl chloride;hydrochloride |
| PubChem CID | 88808185 |
| Molecular Formula | C4H8Cl2N2O |
| Molecular Weight | 171.03 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | 2-amino-3-iminobutanoyl chloride;hydrochloride |
| SMILES | Cl.[H]/N=C(\C)C(N)C(=O)Cl |
| InChI | InChI=1S/C4H7ClN2O.ClH/c1-2(6)3(7)4(5)8;/h3,6H,7H2,1H3;1H/b6-2+; |
| InChIKey | MAUFVVYGCWQYNY-LKZNWTOYSA-N |
| XLogP | 0.54 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.03 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-iminobutanoyl chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-iminobutanoyl chloride;hydrochloride?
The IUPAC name of 2-amino-3-iminobutanoyl chloride;hydrochloride (CID 88808185) is 2-amino-3-iminobutanoyl chloride;hydrochloride.
What is the SMILES notation for 2-amino-3-iminobutanoyl chloride;hydrochloride?
The canonical SMILES for 2-amino-3-iminobutanoyl chloride;hydrochloride is Cl.[H]/N=C(\C)C(N)C(=O)Cl.
What is the InChIKey of 2-amino-3-iminobutanoyl chloride;hydrochloride?
The InChIKey is MAUFVVYGCWQYNY-LKZNWTOYSA-N. The full InChI is InChI=1S/C4H7ClN2O.ClH/c1-2(6)3(7)4(5)8;/h3,6H,7H2,1H3;1H/b6-2+;.
What are the key properties of 2-amino-3-iminobutanoyl chloride;hydrochloride?
2-amino-3-iminobutanoyl chloride;hydrochloride has a molecular weight of 171.03 g/mol, XLogP of 0.54, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-iminobutanoyl chloride;hydrochloride is sourced from PubChem (CID 88808185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).