C8H10N2 — CID 91068179
(Z,3Z)-2-methylidene-N-(methylideneamino)hexa-3,5-dien-1-imine (PubChem CID 91068179) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is (Z,3Z)-2-methylidene-N-(methylideneamino)hexa-3,5-dien-1-imine.
| Compound Name | (Z,3Z)-2-methylidene-N-(methylideneamino)hexa-3,5-dien-1-imine |
|---|---|
| PubChem CID | 91068179 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | (Z,3Z)-2-methylidene-N-(methylideneamino)hexa-3,5-dien-1-imine |
| SMILES | C=C/C=C\C(=C)/C=N/N=C |
| InChI | InChI=1S/C8H10N2/c1-4-5-6-8(2)7-10-9-3/h4-7H,1-3H2/b6-5-,10-7- |
| InChIKey | SDLSKPGZOHCMES-ICZHLNMZSA-N |
| XLogP | 1.97 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|