C6H8ClNO — CID 131976740
(NE)-N-[(2Z,4E)-5-chlorohexa-2,4-dienylidene]hydroxylamine (PubChem CID 131976740) has the molecular formula C6H8ClNO and a molecular weight of 145.59 g/mol. Its IUPAC name is (NE)-N-[(2Z,4E)-5-chlorohexa-2,4-dienylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2Z,4E)-5-chlorohexa-2,4-dienylidene]hydroxylamine |
|---|---|
| PubChem CID | 131976740 |
| Molecular Formula | C6H8ClNO |
| Molecular Weight | 145.59 g/mol |
| Exact Mass | 145.03 |
| IUPAC Name | (NE)-N-[(2Z,4E)-5-chlorohexa-2,4-dienylidene]hydroxylamine |
| SMILES | C/C(Cl)=C\C=C/C=N/O |
| InChI | InChI=1S/C6H8ClNO/c1-6(7)4-2-3-5-8-9/h2-5,9H,1H3/b3-2-,6-4+,8-5+ |
| InChIKey | LGCGMQBFBKTFMB-PDDMAJEVSA-N |
| XLogP | 2.15 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.59 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|