About methyl (4Z,6E)-7-chloroocta-4,6-dienoate
methyl (4Z,6E)-7-chloroocta-4,6-dienoate (PubChem CID 131856006) has the molecular formula C9H13ClO2
and a molecular weight of 188.65 g/mol. Its IUPAC name is methyl (4Z,6E)-7-chloroocta-4,6-dienoate.
Molecular Properties
| Compound Name | methyl (4Z,6E)-7-chloroocta-4,6-dienoate |
| PubChem CID | 131856006 |
| Molecular Formula | C9H13ClO2 |
| Molecular Weight | 188.65 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | methyl (4Z,6E)-7-chloroocta-4,6-dienoate |
| SMILES | COC(=O)CC/C=C\C=C(/C)Cl |
| InChI | InChI=1S/C9H13ClO2/c1-8(10)6-4-3-5-7-9(11)12-2/h3-4,6H,5,7H2,1-2H3/b4-3-,8-6+ |
| InChIKey | SENDOAXKMZXRMH-OONGGIDMSA-N |
| XLogP | 2.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.65 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl (4Z,6E)-7-chloroocta-4,6-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4Z,6E)-7-chloroocta-4,6-dienoate?
The IUPAC name of methyl (4Z,6E)-7-chloroocta-4,6-dienoate (CID 131856006) is methyl (4Z,6E)-7-chloroocta-4,6-dienoate.
What is the SMILES notation for methyl (4Z,6E)-7-chloroocta-4,6-dienoate?
The canonical SMILES for methyl (4Z,6E)-7-chloroocta-4,6-dienoate is COC(=O)CC/C=C\C=C(/C)Cl.
What is the InChIKey of methyl (4Z,6E)-7-chloroocta-4,6-dienoate?
The InChIKey is SENDOAXKMZXRMH-OONGGIDMSA-N. The full InChI is InChI=1S/C9H13ClO2/c1-8(10)6-4-3-5-7-9(11)12-2/h3-4,6H,5,7H2,1-2H3/b4-3-,8-6+.
What are the key properties of methyl (4Z,6E)-7-chloroocta-4,6-dienoate?
methyl (4Z,6E)-7-chloroocta-4,6-dienoate has a molecular weight of 188.65 g/mol, XLogP of 2.64, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4Z,6E)-7-chloroocta-4,6-dienoate is sourced from PubChem (CID 131856006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).