C9H13Cl — CID 142147168
(5Z,7E)-8-chloronona-1,5,7-triene (PubChem CID 142147168) has the molecular formula C9H13Cl and a molecular weight of 156.66 g/mol. Its IUPAC name is (5Z,7E)-8-chloronona-1,5,7-triene.
| Compound Name | (5Z,7E)-8-chloronona-1,5,7-triene |
|---|---|
| PubChem CID | 142147168 |
| Molecular Formula | C9H13Cl |
| Molecular Weight | 156.66 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | (5Z,7E)-8-chloronona-1,5,7-triene |
| SMILES | C=CCC/C=C\C=C(/C)Cl |
| InChI | InChI=1S/C9H13Cl/c1-3-4-5-6-7-8-9(2)10/h3,6-8H,1,4-5H2,2H3/b7-6-,9-8+ |
| InChIKey | NVEVSHHFXIWIOD-NMMTYZSQSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.66 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|