C17H23ClN2O3 — CID 167013080
4-[[2-[(1E,3E)-4-chloro-5-methylhexa-1,3,5-trienoxy]acetyl]amino]-2-methylidene-N-prop-1-en-2-ylbutanamide (PubChem CID 167013080) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is 4-[[2-[(1E,3E)-4-chloro-5-methylhexa-1,3,5-trienoxy]acetyl]amino]-2-methylidene-N-prop-1-en-2-ylbutanamide.
| Compound Name | 4-[[2-[(1E,3E)-4-chloro-5-methylhexa-1,3,5-trienoxy]acetyl]amino]-2-methylidene-N-prop-1-en-2-ylbutanamide |
|---|---|
| PubChem CID | 167013080 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 4-[[2-[(1E,3E)-4-chloro-5-methylhexa-1,3,5-trienoxy]acetyl]amino]-2-methylidene-N-prop-1-en-2-ylbutanamide |
| SMILES | C=C(C)NC(=O)C(=C)CCNC(=O)CO/C=C/C=C(/Cl)C(=C)C |
| InChI | InChI=1S/C17H23ClN2O3/c1-12(2)15(18)7-6-10-23-11-16(21)19-9-8-14(5)17(22)20-13(3)4/h6-7,10H,1,3,5,8-9,11H2,2,4H3,(H,19,21)(H,20,22)/b10-6+,15-7+ |
| InChIKey | NBEHMKXUJNYIQZ-NNGXMHFZSA-N |
| XLogP | 2.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|