C22H29ClN2O3 — CID 167012627
4-[[2-[(3E,5E)-6-chloro-5-methylhexa-1,3,5-trien-3-yl]oxyacetyl]amino]-2-methylidene-N-[(2E)-2-[(E)-prop-1-enyl]penta-2,4-dienyl]butanamide (PubChem CID 167012627) has the molecular formula C22H29ClN2O3 and a molecular weight of 404.94 g/mol. Its IUPAC name is 4-[[2-[(3E,5E)-6-chloro-5-methylhexa-1,3,5-trien-3-yl]oxyacetyl]amino]-2-methylidene-N-[(2E)-2-[(E)-prop-1-enyl]penta-2,4-dienyl]butanamide.
| Compound Name | 4-[[2-[(3E,5E)-6-chloro-5-methylhexa-1,3,5-trien-3-yl]oxyacetyl]amino]-2-methylidene-N-[(2E)-2-[(E)-prop-1-enyl]penta-2,4-dienyl]butanamide |
|---|---|
| PubChem CID | 167012627 |
| Molecular Formula | C22H29ClN2O3 |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 4-[[2-[(3E,5E)-6-chloro-5-methylhexa-1,3,5-trien-3-yl]oxyacetyl]amino]-2-methylidene-N-[(2E)-2-[(E)-prop-1-enyl]penta-2,4-dienyl]butanamide |
| SMILES | C=C/C=C(\C=C\C)CNC(=O)C(=C)CCNC(=O)CO/C(C=C)=C/C(C)=C/Cl |
| InChI | InChI=1S/C22H29ClN2O3/c1-6-9-19(10-7-2)15-25-22(27)18(5)11-12-24-21(26)16-28-20(8-3)13-17(4)14-23/h6-10,13-14H,1,3,5,11-12,15-16H2,2,4H3,(H,24,26)(H,25,27)/b10-7+,17-14+,19-9+,20-13+ |
| InChIKey | VKXDEUYDOHRNRI-ZJSFOEDLSA-N |
| XLogP | 4.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|