C28H39NO3 — CID 167560480
(2Z,4E,6E,8E)-9-[6-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-4-ethyl-2-oxohexoxy]-4-ethylideneundeca-2,6,8,10-tetraen-5-one (PubChem CID 167560480) has the molecular formula C28H39NO3 and a molecular weight of 437.62 g/mol. Its IUPAC name is (2Z,4E,6E,8E)-9-[6-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-4-ethyl-2-oxohexoxy]-4-ethylideneundeca-2,6,8,10-tetraen-5-one.
| Compound Name | (2Z,4E,6E,8E)-9-[6-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-4-ethyl-2-oxohexoxy]-4-ethylideneundeca-2,6,8,10-tetraen-5-one |
|---|---|
| PubChem CID | 167560480 |
| Molecular Formula | C28H39NO3 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | (2Z,4E,6E,8E)-9-[6-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-4-ethyl-2-oxohexoxy]-4-ethylideneundeca-2,6,8,10-tetraen-5-one |
| SMILES | C=C/C=C(\C=C)CNCCC(CC)CC(=O)CO/C(C=C)=C/C=C/C(=O)C(/C=C\C)=C/C |
| InChI | InChI=1S/C28H39NO3/c1-7-14-24(10-4)21-29-19-18-23(9-3)20-26(30)22-32-27(12-6)16-13-17-28(31)25(11-5)15-8-2/h7-8,10-17,23,29H,1,4,6,9,18-22H2,2-3,5H3/b15-8-,17-13+,24-14+,25-11+,27-16+ |
| InChIKey | DPADTEGGZJEQJJ-UKPVENNZSA-N |
| XLogP | 5.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|