C19H22O8 — CID 146383095
(2R,3R)-2-[(Z,2E)-2-ethylidenepent-3-enoyl]oxy-3-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoyl]oxybutanedioic acid (PubChem CID 146383095) has the molecular formula C19H22O8 and a molecular weight of 378.38 g/mol. Its IUPAC name is (2R,3R)-2-[(Z,2E)-2-ethylidenepent-3-enoyl]oxy-3-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoyl]oxybutanedioic acid.
| Compound Name | (2R,3R)-2-[(Z,2E)-2-ethylidenepent-3-enoyl]oxy-3-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoyl]oxybutanedioic acid |
|---|---|
| PubChem CID | 146383095 |
| Molecular Formula | C19H22O8 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (2R,3R)-2-[(Z,2E)-2-ethylidenepent-3-enoyl]oxy-3-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoyl]oxybutanedioic acid |
| SMILES | C=C/C=C(\C=C/C)C(=O)O[C@@H](C(=O)O)[C@@H](OC(=O)C(/C=C\C)=C/C)C(=O)O |
| InChI | InChI=1S/C19H22O8/c1-5-9-12(8-4)18(24)26-14(16(20)21)15(17(22)23)27-19(25)13(10-6-2)11-7-3/h5-11,14-15H,2H2,1,3-4H3,(H,20,21)(H,22,23)/b9-5-,11-7-,12-8+,13-10+/t14-,15-/m1/s1 |
| InChIKey | RPUSUEIFHCDJTO-IOCTVAJQSA-N |
| XLogP | 2.19 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|