C20H22O8 — CID 146383093
(2S,3S)-2-[(2E,3Z)-2-ethylidenehexa-3,5-dienoyl]oxy-3-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoyl]oxybutanedioic acid (PubChem CID 146383093) has the molecular formula C20H22O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is (2S,3S)-2-[(2E,3Z)-2-ethylidenehexa-3,5-dienoyl]oxy-3-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoyl]oxybutanedioic acid.
| Compound Name | (2S,3S)-2-[(2E,3Z)-2-ethylidenehexa-3,5-dienoyl]oxy-3-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoyl]oxybutanedioic acid |
|---|---|
| PubChem CID | 146383093 |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | (2S,3S)-2-[(2E,3Z)-2-ethylidenehexa-3,5-dienoyl]oxy-3-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienoyl]oxybutanedioic acid |
| SMILES | C=C/C=C\C(=C/C)C(=O)O[C@H](C(=O)O)[C@H](OC(=O)C(/C=C\C)=C/C=C)C(=O)O |
| InChI | InChI=1S/C20H22O8/c1-5-9-12-13(8-4)19(25)27-15(17(21)22)16(18(23)24)28-20(26)14(10-6-2)11-7-3/h5-12,15-16H,1-2H2,3-4H3,(H,21,22)(H,23,24)/b11-7-,12-9-,13-8+,14-10+/t15-,16-/m0/s1 |
| InChIKey | NUBNWAGTXPMSBR-KAZHFKLFSA-N |
| XLogP | 2.36 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|