C12H16O3 — CID 155380132
2-hydroxypropyl (2E,3Z)-2-prop-2-enylidenehexa-3,5-dienoate (PubChem CID 155380132) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-hydroxypropyl (2E,3Z)-2-prop-2-enylidenehexa-3,5-dienoate.
| Compound Name | 2-hydroxypropyl (2E,3Z)-2-prop-2-enylidenehexa-3,5-dienoate |
|---|---|
| PubChem CID | 155380132 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2-hydroxypropyl (2E,3Z)-2-prop-2-enylidenehexa-3,5-dienoate |
| SMILES | C=C/C=C\C(=C/C=C)C(=O)OCC(C)O |
| InChI | InChI=1S/C12H16O3/c1-4-6-8-11(7-5-2)12(14)15-9-10(3)13/h4-8,10,13H,1-2,9H2,3H3/b8-6-,11-7+ |
| InChIKey | PXHKJBZJKWNJLP-FAWHLJIPSA-N |
| XLogP | 1.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|