C27H40N2O4 — CID 143654681
(3Z)-6-[(dimethylamino)methyl]-4-[2-[(2E,3Z)-2-ethylidenehexa-3,5-dienoyl]oxypentan-3-ylideneamino]-2-methyl-3-[(Z)-prop-1-enyl]hepta-3,6-dienoic acid (PubChem CID 143654681) has the molecular formula C27H40N2O4 and a molecular weight of 456.63 g/mol. Its IUPAC name is (3Z)-6-[(dimethylamino)methyl]-4-[2-[(2E,3Z)-2-ethylidenehexa-3,5-dienoyl]oxypentan-3-ylideneamino]-2-methyl-3-[(Z)-prop-1-enyl]hepta-3,6-dienoic acid.
| Compound Name | (3Z)-6-[(dimethylamino)methyl]-4-[2-[(2E,3Z)-2-ethylidenehexa-3,5-dienoyl]oxypentan-3-ylideneamino]-2-methyl-3-[(Z)-prop-1-enyl]hepta-3,6-dienoic acid |
|---|---|
| PubChem CID | 143654681 |
| Molecular Formula | C27H40N2O4 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | (3Z)-6-[(dimethylamino)methyl]-4-[2-[(2E,3Z)-2-ethylidenehexa-3,5-dienoyl]oxypentan-3-ylideneamino]-2-methyl-3-[(Z)-prop-1-enyl]hepta-3,6-dienoic acid |
| SMILES | C=C/C=C\C(=C/C)C(=O)OC(C)/C(CC)=N/C(CC(=C)CN(C)C)=C(/C=C\C)C(C)C(=O)O |
| InChI | InChI=1S/C27H40N2O4/c1-10-14-16-22(12-3)27(32)33-21(7)24(13-4)28-25(17-19(5)18-29(8)9)23(15-11-2)20(6)26(30)31/h10-12,14-16,20-21H,1,5,13,17-18H2,2-4,6-9H3,(H,30,31)/b15-11-,16-14-,22-12+,25-23-,28-24+ |
| InChIKey | ZLLFEHAENKVVBN-MSJLNRQBSA-N |
| XLogP | 5.52 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|