C13H23NO3 — CID 145170354
2-(dimethylamino)acetic acid;(3Z,5E)-5-(methoxymethyl)hepta-1,3,5-triene (PubChem CID 145170354) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-(dimethylamino)acetic acid;(3Z,5E)-5-(methoxymethyl)hepta-1,3,5-triene.
| Compound Name | 2-(dimethylamino)acetic acid;(3Z,5E)-5-(methoxymethyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 145170354 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 2-(dimethylamino)acetic acid;(3Z,5E)-5-(methoxymethyl)hepta-1,3,5-triene |
| SMILES | C=C/C=C\C(=C/C)COC.CN(C)CC(=O)O |
| InChI | InChI=1S/C9H14O.C4H9NO2/c1-4-6-7-9(5-2)8-10-3;1-5(2)3-4(6)7/h4-7H,1,8H2,2-3H3;3H2,1-2H3,(H,6,7)/b7-6-,9-5+; |
| InChIKey | QWCXIVDXYZTKAU-YVCPEMMASA-N |
| XLogP | 1.95 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|