2-[(2-methoxyacetyl)-methylamino]acetic acid

C6H11NO4 — CID 16777253

IUPAC2-[(2-methoxyacetyl)-methylamino]acetic acid
SMILESCOCC(=O)N(C)CC(=O)O
InChIInChI=1S/C6H11NO4/c1-7(3-6(9)10)5(8)4-11-2/h3-4H2,1-2H3,(H,9,10)
InChIKeyKIAUQLWVQFRPCR-UHFFFAOYSA-N
MW161.16 g/mol
LogP-0.82
Rot. Bonds4

About 2-[(2-methoxyacetyl)-methylamino]acetic acid

2-[(2-methoxyacetyl)-methylamino]acetic acid (PubChem CID 16777253) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is 2-[(2-methoxyacetyl)-methylamino]acetic acid.

Molecular Properties

Compound Name2-[(2-methoxyacetyl)-methylamino]acetic acid
PubChem CID16777253
Molecular FormulaC6H11NO4
Molecular Weight161.16 g/mol
Exact Mass161.07
IUPAC Name2-[(2-methoxyacetyl)-methylamino]acetic acid
SMILESCOCC(=O)N(C)CC(=O)O
InChIInChI=1S/C6H11NO4/c1-7(3-6(9)10)5(8)4-11-2/h3-4H2,1-2H3,(H,9,10)
InChIKeyKIAUQLWVQFRPCR-UHFFFAOYSA-N
XLogP-0.82
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.16
LogP ≤ 5-0.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[(2-methoxyacetyl)-methylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-methoxy-N-methyl-N-(3-methyl-2-oxobutyl)acetamide
CID 170610348
2-[[2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxyacetyl]-methylamino]acetic acid
CID 46179361
ethane;2-[methyl(propanoyl)amino]acetic acid
CID 170570723
2-[(2-methoxyacetyl)-propan-2-ylamino]acetic acid
CID 61276953
2-[(2-cyclohexyloxyacetyl)-methylamino]acetic acid
CID 115729870
2-[[2-[acetyl(methyl)amino]acetyl]-methylamino]acetic acid
CID 43356271
2-[(2-aminoacetyl)-methylamino]acetic acid;hydrochloride
CID 87629075
2-[(2-methoxyacetyl)-(2,2,2-trifluoroethyl)amino]acetic acid
CID 79261024
2-[[2-(azetidin-3-yl)acetyl]-methylamino]acetic acid
CID 64609754
2-methoxyacetic acid;titanium
CID 174298740
2-methoxyacetic acid;silver
CID 158784523
2-[dimethylcarbamoyl(methyl)amino]acetic acid
CID 43135260

Frequently Asked Questions

What is the IUPAC name of 2-[(2-methoxyacetyl)-methylamino]acetic acid?
The IUPAC name of 2-[(2-methoxyacetyl)-methylamino]acetic acid (CID 16777253) is 2-[(2-methoxyacetyl)-methylamino]acetic acid.
What is the SMILES notation for 2-[(2-methoxyacetyl)-methylamino]acetic acid?
The canonical SMILES for 2-[(2-methoxyacetyl)-methylamino]acetic acid is COCC(=O)N(C)CC(=O)O.
What is the InChIKey of 2-[(2-methoxyacetyl)-methylamino]acetic acid?
The InChIKey is KIAUQLWVQFRPCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO4/c1-7(3-6(9)10)5(8)4-11-2/h3-4H2,1-2H3,(H,9,10).
What are the key properties of 2-[(2-methoxyacetyl)-methylamino]acetic acid?
2-[(2-methoxyacetyl)-methylamino]acetic acid has a molecular weight of 161.16 g/mol, XLogP of -0.82, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methoxyacetyl)-methylamino]acetic acid is sourced from PubChem (CID 16777253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).