C27H48N4O6 — CID 156645991
N'-tert-butyl-N-[2-[2-[3-[2-[2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-2-oxoethoxy]ethylamino]propoxy]ethoxy]ethyl]pentanediamide (PubChem CID 156645991) has the molecular formula C27H48N4O6 and a molecular weight of 524.70 g/mol. Its IUPAC name is N'-tert-butyl-N-[2-[2-[3-[2-[2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-2-oxoethoxy]ethylamino]propoxy]ethoxy]ethyl]pentanediamide.
| Compound Name | N'-tert-butyl-N-[2-[2-[3-[2-[2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-2-oxoethoxy]ethylamino]propoxy]ethoxy]ethyl]pentanediamide |
|---|---|
| PubChem CID | 156645991 |
| Molecular Formula | C27H48N4O6 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.36 |
| IUPAC Name | N'-tert-butyl-N-[2-[2-[3-[2-[2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-2-oxoethoxy]ethylamino]propoxy]ethoxy]ethyl]pentanediamide |
| SMILES | C=C/C=C(\C=C)CNC(=O)COCCNCCCOCCOCCNC(=O)CCCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C27H48N4O6/c1-6-10-23(7-2)21-30-26(34)22-37-17-14-28-13-9-16-35-19-20-36-18-15-29-24(32)11-8-12-25(33)31-27(3,4)5/h6-7,10,28H,1-2,8-9,11-22H2,3-5H3,(H,29,32)(H,30,34)(H,31,33)/b23-10+ |
| InChIKey | XPXKKZHTJYFZNG-AUEPDCJTSA-N |
| XLogP | 1.63 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|