C24H48N2O6 — CID 90290747
N-[2-[2-[2-[2-[3-(tert-butylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]-6,6-dimethylheptanamide (PubChem CID 90290747) has the molecular formula C24H48N2O6 and a molecular weight of 460.66 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[3-(tert-butylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]-6,6-dimethylheptanamide.
| Compound Name | N-[2-[2-[2-[2-[3-(tert-butylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]-6,6-dimethylheptanamide |
|---|---|
| PubChem CID | 90290747 |
| Molecular Formula | C24H48N2O6 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.35 |
| IUPAC Name | N-[2-[2-[2-[2-[3-(tert-butylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]-6,6-dimethylheptanamide |
| SMILES | CC(C)(C)CCCCC(=O)NCCOCCOCCOCCOCCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C24H48N2O6/c1-23(2,3)11-8-7-9-21(27)25-12-14-30-16-18-32-20-19-31-17-15-29-13-10-22(28)26-24(4,5)6/h7-20H2,1-6H3,(H,25,27)(H,26,28) |
| InChIKey | KQMHMVQLKCVRGH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|