C22H44N2O3S — CID 135193572
N-[2-[2-[3-(2,2-dimethylpropylsulfanyl)propanoylamino]ethoxy]ethyl]-7,7-dimethyloctanamide (PubChem CID 135193572) has the molecular formula C22H44N2O3S and a molecular weight of 416.67 g/mol. Its IUPAC name is N-[2-[2-[3-(2,2-dimethylpropylsulfanyl)propanoylamino]ethoxy]ethyl]-7,7-dimethyloctanamide.
| Compound Name | N-[2-[2-[3-(2,2-dimethylpropylsulfanyl)propanoylamino]ethoxy]ethyl]-7,7-dimethyloctanamide |
|---|---|
| PubChem CID | 135193572 |
| Molecular Formula | C22H44N2O3S |
| Molecular Weight | 416.67 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | N-[2-[2-[3-(2,2-dimethylpropylsulfanyl)propanoylamino]ethoxy]ethyl]-7,7-dimethyloctanamide |
| SMILES | CC(C)(C)CCCCCC(=O)NCCOCCNC(=O)CCSCC(C)(C)C |
| InChI | InChI=1S/C22H44N2O3S/c1-21(2,3)12-9-7-8-10-19(25)23-13-15-27-16-14-24-20(26)11-17-28-18-22(4,5)6/h7-18H2,1-6H3,(H,23,25)(H,24,26) |
| InChIKey | HFFAGSLWEJKFQD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.67 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|