C11H15ClFNO2 — CID 170000286
2-[(3E,5Z)-6-chloro-5-fluorohexa-1,3,5-trien-3-yl]oxy-N-propylacetamide (PubChem CID 170000286) has the molecular formula C11H15ClFNO2 and a molecular weight of 247.70 g/mol. Its IUPAC name is 2-[(3E,5Z)-6-chloro-5-fluorohexa-1,3,5-trien-3-yl]oxy-N-propylacetamide.
| Compound Name | 2-[(3E,5Z)-6-chloro-5-fluorohexa-1,3,5-trien-3-yl]oxy-N-propylacetamide |
|---|---|
| PubChem CID | 170000286 |
| Molecular Formula | C11H15ClFNO2 |
| Molecular Weight | 247.70 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-[(3E,5Z)-6-chloro-5-fluorohexa-1,3,5-trien-3-yl]oxy-N-propylacetamide |
| SMILES | C=C/C(=C\C(F)=C\Cl)OCC(=O)NCCC |
| InChI | InChI=1S/C11H15ClFNO2/c1-3-5-14-11(15)8-16-10(4-2)6-9(13)7-12/h4,6-7H,2-3,5,8H2,1H3,(H,14,15)/b9-7-,10-6+ |
| InChIKey | WSIFLAYFULFWNR-ODUODFHUSA-N |
| XLogP | 2.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.70 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|