C15H21ClFNO2 — CID 170086023
2-[(3E,5Z)-6-chloro-5-fluorohexa-1,3,5-trien-3-yl]oxy-N-(4-methylhex-5-enyl)acetamide (PubChem CID 170086023) has the molecular formula C15H21ClFNO2 and a molecular weight of 301.79 g/mol. Its IUPAC name is 2-[(3E,5Z)-6-chloro-5-fluorohexa-1,3,5-trien-3-yl]oxy-N-(4-methylhex-5-enyl)acetamide.
| Compound Name | 2-[(3E,5Z)-6-chloro-5-fluorohexa-1,3,5-trien-3-yl]oxy-N-(4-methylhex-5-enyl)acetamide |
|---|---|
| PubChem CID | 170086023 |
| Molecular Formula | C15H21ClFNO2 |
| Molecular Weight | 301.79 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-[(3E,5Z)-6-chloro-5-fluorohexa-1,3,5-trien-3-yl]oxy-N-(4-methylhex-5-enyl)acetamide |
| SMILES | C=C/C(=C\C(F)=C\Cl)OCC(=O)NCCCC(C)C=C |
| InChI | InChI=1S/C15H21ClFNO2/c1-4-12(3)7-6-8-18-15(19)11-20-14(5-2)9-13(17)10-16/h4-5,9-10,12H,1-2,6-8,11H2,3H3,(H,18,19)/b13-10-,14-9+ |
| InChIKey | KTRXUJWYUSFMRX-QWWBJACISA-N |
| XLogP | 3.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.79 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|