C19H21ClFN3O3 — CID 170000937
N-[4-[[2-[(3E,5Z)-6-chloro-5-fluorohexa-1,3,5-trien-3-yl]oxyacetyl]amino]but-1-en-2-yl]-5-methylpyridine-3-carboxamide (PubChem CID 170000937) has the molecular formula C19H21ClFN3O3 and a molecular weight of 393.85 g/mol. Its IUPAC name is N-[4-[[2-[(3E,5Z)-6-chloro-5-fluorohexa-1,3,5-trien-3-yl]oxyacetyl]amino]but-1-en-2-yl]-5-methylpyridine-3-carboxamide.
| Compound Name | N-[4-[[2-[(3E,5Z)-6-chloro-5-fluorohexa-1,3,5-trien-3-yl]oxyacetyl]amino]but-1-en-2-yl]-5-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 170000937 |
| Molecular Formula | C19H21ClFN3O3 |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-[4-[[2-[(3E,5Z)-6-chloro-5-fluorohexa-1,3,5-trien-3-yl]oxyacetyl]amino]but-1-en-2-yl]-5-methylpyridine-3-carboxamide |
| SMILES | C=C/C(=C\C(F)=C\Cl)OCC(=O)NCCC(=C)NC(=O)c1cncc(C)c1 |
| InChI | InChI=1S/C19H21ClFN3O3/c1-4-17(8-16(21)9-20)27-12-18(25)23-6-5-14(3)24-19(26)15-7-13(2)10-22-11-15/h4,7-11H,1,3,5-6,12H2,2H3,(H,23,25)(H,24,26)/b16-9-,17-8+ |
| InChIKey | VPIQBZSOSORWPJ-MGIQBUIQSA-N |
| XLogP | 3.28 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|