C18H18Cl3N3O3 — CID 170001244
5-chloro-N-[4-[[2-[(3E)-4,5-dichlorohexa-1,3,5-trien-2-yl]oxyacetyl]amino]but-1-en-2-yl]pyridine-2-carboxamide (PubChem CID 170001244) has the molecular formula C18H18Cl3N3O3 and a molecular weight of 430.72 g/mol. Its IUPAC name is 5-chloro-N-[4-[[2-[(3E)-4,5-dichlorohexa-1,3,5-trien-2-yl]oxyacetyl]amino]but-1-en-2-yl]pyridine-2-carboxamide.
| Compound Name | 5-chloro-N-[4-[[2-[(3E)-4,5-dichlorohexa-1,3,5-trien-2-yl]oxyacetyl]amino]but-1-en-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 170001244 |
| Molecular Formula | C18H18Cl3N3O3 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 5-chloro-N-[4-[[2-[(3E)-4,5-dichlorohexa-1,3,5-trien-2-yl]oxyacetyl]amino]but-1-en-2-yl]pyridine-2-carboxamide |
| SMILES | C=C(CCNC(=O)COC(=C)/C=C(/Cl)C(=C)Cl)NC(=O)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C18H18Cl3N3O3/c1-11(24-18(26)16-5-4-14(20)9-23-16)6-7-22-17(25)10-27-12(2)8-15(21)13(3)19/h4-5,8-9H,1-3,6-7,10H2,(H,22,25)(H,24,26)/b15-8+ |
| InChIKey | JYMQXYJGDCQAJO-OVCLIPMQSA-N |
| XLogP | 3.89 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|