C22H21ClFN3O3 — CID 170001069
N-[3-[[2-[(3E)-5-chloro-4-fluorohexa-1,3,5-trien-2-yl]oxyacetyl]amino]but-3-enyl]isoquinoline-3-carboxamide (PubChem CID 170001069) has the molecular formula C22H21ClFN3O3 and a molecular weight of 429.88 g/mol. Its IUPAC name is N-[3-[[2-[(3E)-5-chloro-4-fluorohexa-1,3,5-trien-2-yl]oxyacetyl]amino]but-3-enyl]isoquinoline-3-carboxamide.
| Compound Name | N-[3-[[2-[(3E)-5-chloro-4-fluorohexa-1,3,5-trien-2-yl]oxyacetyl]amino]but-3-enyl]isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 170001069 |
| Molecular Formula | C22H21ClFN3O3 |
| Molecular Weight | 429.88 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | N-[3-[[2-[(3E)-5-chloro-4-fluorohexa-1,3,5-trien-2-yl]oxyacetyl]amino]but-3-enyl]isoquinoline-3-carboxamide |
| SMILES | C=C(CCNC(=O)c1cc2ccccc2cn1)NC(=O)COC(=C)/C=C(/F)C(=C)Cl |
| InChI | InChI=1S/C22H21ClFN3O3/c1-14(27-21(28)13-30-15(2)10-19(24)16(3)23)8-9-25-22(29)20-11-17-6-4-5-7-18(17)12-26-20/h4-7,10-12H,1-3,8-9,13H2,(H,25,29)(H,27,28)/b19-10+ |
| InChIKey | YMGOPHYUROWVNB-VXLYETTFSA-N |
| XLogP | 4.12 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.88 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|