About N-[3,3-bis(4-fluorophenyl)propyl]isoquinoline-3-carboxamide
N-[3,3-bis(4-fluorophenyl)propyl]isoquinoline-3-carboxamide (PubChem CID 45121525) has the molecular formula C25H20F2N2O
and a molecular weight of 402.44 g/mol. Its IUPAC name is N-[3,3-bis(4-fluorophenyl)propyl]isoquinoline-3-carboxamide.
Molecular Properties
| Compound Name | N-[3,3-bis(4-fluorophenyl)propyl]isoquinoline-3-carboxamide |
| PubChem CID | 45121525 |
| Molecular Formula | C25H20F2N2O |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-[3,3-bis(4-fluorophenyl)propyl]isoquinoline-3-carboxamide |
| SMILES | O=C(NCCC(c1ccc(F)cc1)c1ccc(F)cc1)c1cc2ccccc2cn1 |
| InChI | InChI=1S/C25H20F2N2O/c26-21-9-5-17(6-10-21)23(18-7-11-22(27)12-8-18)13-14-28-25(30)24-15-19-3-1-2-4-20(19)16-29-24/h1-12,15-16,23H,13-14H2,(H,28,30) |
| InChIKey | XETJVZOWZRHKLD-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3,3-bis(4-fluorophenyl)propyl]isoquinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,3-bis(4-fluorophenyl)propyl]isoquinoline-3-carboxamide?
The IUPAC name of N-[3,3-bis(4-fluorophenyl)propyl]isoquinoline-3-carboxamide (CID 45121525) is N-[3,3-bis(4-fluorophenyl)propyl]isoquinoline-3-carboxamide.
What is the SMILES notation for N-[3,3-bis(4-fluorophenyl)propyl]isoquinoline-3-carboxamide?
The canonical SMILES for N-[3,3-bis(4-fluorophenyl)propyl]isoquinoline-3-carboxamide is O=C(NCCC(c1ccc(F)cc1)c1ccc(F)cc1)c1cc2ccccc2cn1.
What is the InChIKey of N-[3,3-bis(4-fluorophenyl)propyl]isoquinoline-3-carboxamide?
The InChIKey is XETJVZOWZRHKLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20F2N2O/c26-21-9-5-17(6-10-21)23(18-7-11-22(27)12-8-18)13-14-28-25(30)24-15-19-3-1-2-4-20(19)16-29-24/h1-12,15-16,23H,13-14H2,(H,28,30).
What are the key properties of N-[3,3-bis(4-fluorophenyl)propyl]isoquinoline-3-carboxamide?
N-[3,3-bis(4-fluorophenyl)propyl]isoquinoline-3-carboxamide has a molecular weight of 402.44 g/mol, XLogP of 5.47, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,3-bis(4-fluorophenyl)propyl]isoquinoline-3-carboxamide is sourced from PubChem (CID 45121525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).