C18H23N3O — CID 95194154
N-[2-[(3S)-1-methylpiperidin-3-yl]ethyl]isoquinoline-3-carboxamide (PubChem CID 95194154) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[2-[(3S)-1-methylpiperidin-3-yl]ethyl]isoquinoline-3-carboxamide.
| Compound Name | N-[2-[(3S)-1-methylpiperidin-3-yl]ethyl]isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 95194154 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N-[2-[(3S)-1-methylpiperidin-3-yl]ethyl]isoquinoline-3-carboxamide |
| SMILES | CN1CCC[C@@H](CCNC(=O)c2cc3ccccc3cn2)C1 |
| InChI | InChI=1S/C18H23N3O/c1-21-10-4-5-14(13-21)8-9-19-18(22)17-11-15-6-2-3-7-16(15)12-20-17/h2-3,6-7,11-12,14H,4-5,8-10,13H2,1H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | RZJPSVIVIMBQRV-AWEZNQCLSA-N |
| XLogP | 2.70 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |