C17H28N4O — CID 56722819
4-methyl-N-[2-(1-methylpiperidin-3-yl)ethyl]-2-propan-2-ylpyrimidine-5-carboxamide (PubChem CID 56722819) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is 4-methyl-N-[2-(1-methylpiperidin-3-yl)ethyl]-2-propan-2-ylpyrimidine-5-carboxamide.
| Compound Name | 4-methyl-N-[2-(1-methylpiperidin-3-yl)ethyl]-2-propan-2-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 56722819 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 4-methyl-N-[2-(1-methylpiperidin-3-yl)ethyl]-2-propan-2-ylpyrimidine-5-carboxamide |
| SMILES | Cc1nc(C(C)C)ncc1C(=O)NCCC1CCCN(C)C1 |
| InChI | InChI=1S/C17H28N4O/c1-12(2)16-19-10-15(13(3)20-16)17(22)18-8-7-14-6-5-9-21(4)11-14/h10,12,14H,5-9,11H2,1-4H3,(H,18,22) |
| InChIKey | KGVUPOXGVUPXPU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |