C19H25N5O4 — CID 102336709
3-N,5-N-bis[3-(prop-2-enoylamino)propyl]pyridine-3,5-dicarboxamide (PubChem CID 102336709) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-N,5-N-bis[3-(prop-2-enoylamino)propyl]pyridine-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis[3-(prop-2-enoylamino)propyl]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 102336709 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 3-N,5-N-bis[3-(prop-2-enoylamino)propyl]pyridine-3,5-dicarboxamide |
| SMILES | C=CC(=O)NCCCNC(=O)c1cncc(C(=O)NCCCNC(=O)C=C)c1 |
| InChI | InChI=1S/C19H25N5O4/c1-3-16(25)21-7-5-9-23-18(27)14-11-15(13-20-12-14)19(28)24-10-6-8-22-17(26)4-2/h3-4,11-13H,1-2,5-10H2,(H,21,25)(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | UHKHSUVMFHDMDM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|