C20H28N5O4+ — CID 102336713
1-methyl-3-N,5-N-bis[3-(prop-2-enoylamino)propyl]pyridin-1-ium-3,5-dicarboxamide (PubChem CID 102336713) has the molecular formula C20H28N5O4+ and a molecular weight of 402.48 g/mol. Its IUPAC name is 1-methyl-3-N,5-N-bis[3-(prop-2-enoylamino)propyl]pyridin-1-ium-3,5-dicarboxamide.
| Compound Name | 1-methyl-3-N,5-N-bis[3-(prop-2-enoylamino)propyl]pyridin-1-ium-3,5-dicarboxamide |
|---|---|
| PubChem CID | 102336713 |
| Molecular Formula | C20H28N5O4+ |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 1-methyl-3-N,5-N-bis[3-(prop-2-enoylamino)propyl]pyridin-1-ium-3,5-dicarboxamide |
| SMILES | C=CC(=O)NCCCNC(=O)c1cc(C(=O)NCCCNC(=O)C=C)c[n+](C)c1 |
| InChI | InChI=1S/C20H27N5O4/c1-4-17(26)21-8-6-10-23-19(28)15-12-16(14-25(3)13-15)20(29)24-11-7-9-22-18(27)5-2/h4-5,12-14H,1-2,6-11H2,3H3,(H3-,21,22,23,24,26,27,28,29)/p+1 |
| InChIKey | USDAAFNJAPDPBP-UHFFFAOYSA-O |
| XLogP | -0.64 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|