C22H34N3O6+ — CID 144594754
bis[2-(prop-2-enoylamino)ethyl] 1-methylpyridin-1-ium-3,5-dicarboxylate;ethane (PubChem CID 144594754) has the molecular formula C22H34N3O6+ and a molecular weight of 436.53 g/mol. Its IUPAC name is bis[2-(prop-2-enoylamino)ethyl] 1-methylpyridin-1-ium-3,5-dicarboxylate;ethane.
| Compound Name | bis[2-(prop-2-enoylamino)ethyl] 1-methylpyridin-1-ium-3,5-dicarboxylate;ethane |
|---|---|
| PubChem CID | 144594754 |
| Molecular Formula | C22H34N3O6+ |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | bis[2-(prop-2-enoylamino)ethyl] 1-methylpyridin-1-ium-3,5-dicarboxylate;ethane |
| SMILES | C=CC(=O)NCCOC(=O)c1cc(C(=O)OCCNC(=O)C=C)c[n+](C)c1.CC.CC |
| InChI | InChI=1S/C18H21N3O6.2C2H6/c1-4-15(22)19-6-8-26-17(24)13-10-14(12-21(3)11-13)18(25)27-9-7-20-16(23)5-2;2*1-2/h4-5,10-12H,1-2,6-9H2,3H3,(H-,19,20,22,23);2*1-2H3/p+1 |
| InChIKey | GLUIKJLFPOIXFY-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|