C20H24INO6 — CID 159930841
bis(4-oxohex-5-enyl) 1-methylpyridin-1-ium-3,5-dicarboxylate iodide (PubChem CID 159930841) has the molecular formula C20H24INO6 and a molecular weight of 501.32 g/mol. Its IUPAC name is bis(4-oxohex-5-enyl) 1-methylpyridin-1-ium-3,5-dicarboxylate iodide.
| Compound Name | bis(4-oxohex-5-enyl) 1-methylpyridin-1-ium-3,5-dicarboxylate iodide |
|---|---|
| PubChem CID | 159930841 |
| Molecular Formula | C20H24INO6 |
| Molecular Weight | 501.32 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | bis(4-oxohex-5-enyl) 1-methylpyridin-1-ium-3,5-dicarboxylate iodide |
| SMILES | C=CC(=O)CCCOC(=O)c1cc(C(=O)OCCCC(=O)C=C)c[n+](C)c1.[I-] |
| InChI | InChI=1S/C20H24NO6.HI/c1-4-17(22)8-6-10-26-19(24)15-12-16(14-21(3)13-15)20(25)27-11-7-9-18(23)5-2;/h4-5,12-14H,1-2,6-11H2,3H3;1H/q+1;/p-1 |
| InChIKey | XZHQKHNEVAYWRH-UHFFFAOYSA-M |
| XLogP | -1.10 |
| TPSA | 90.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.32 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|