C24H24O8 — CID 58612781
methyl 4-[4-(6-oxooct-7-enoxycarbonyloxy)benzoyl]oxybenzoate (PubChem CID 58612781) has the molecular formula C24H24O8 and a molecular weight of 440.45 g/mol. Its IUPAC name is methyl 4-[4-(6-oxooct-7-enoxycarbonyloxy)benzoyl]oxybenzoate.
| Compound Name | methyl 4-[4-(6-oxooct-7-enoxycarbonyloxy)benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 58612781 |
| Molecular Formula | C24H24O8 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | methyl 4-[4-(6-oxooct-7-enoxycarbonyloxy)benzoyl]oxybenzoate |
| SMILES | C=CC(=O)CCCCCOC(=O)Oc1ccc(C(=O)Oc2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C24H24O8/c1-3-19(25)7-5-4-6-16-30-24(28)32-21-14-10-18(11-15-21)23(27)31-20-12-8-17(9-13-20)22(26)29-2/h3,8-15H,1,4-7,16H2,2H3 |
| InChIKey | NMTHGFLBVGIFEV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|