C39H42O12 — CID 146495966
[2-methyl-4-[2-oxo-2-[4-(6-oxooct-7-enoxycarbonyloxy)phenyl]ethyl]phenyl] 4-(4-propanoyloxybutoxycarbonyloxy)benzoate (PubChem CID 146495966) has the molecular formula C39H42O12 and a molecular weight of 702.75 g/mol. Its IUPAC name is [2-methyl-4-[2-oxo-2-[4-(6-oxooct-7-enoxycarbonyloxy)phenyl]ethyl]phenyl] 4-(4-propanoyloxybutoxycarbonyloxy)benzoate.
| Compound Name | [2-methyl-4-[2-oxo-2-[4-(6-oxooct-7-enoxycarbonyloxy)phenyl]ethyl]phenyl] 4-(4-propanoyloxybutoxycarbonyloxy)benzoate |
|---|---|
| PubChem CID | 146495966 |
| Molecular Formula | C39H42O12 |
| Molecular Weight | 702.75 g/mol |
| Exact Mass | 702.27 |
| IUPAC Name | [2-methyl-4-[2-oxo-2-[4-(6-oxooct-7-enoxycarbonyloxy)phenyl]ethyl]phenyl] 4-(4-propanoyloxybutoxycarbonyloxy)benzoate |
| SMILES | C=CC(=O)CCCCCOC(=O)Oc1ccc(C(=O)Cc2ccc(OC(=O)c3ccc(OC(=O)OCCCCOC(=O)CC)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C39H42O12/c1-4-31(40)11-7-6-8-23-47-38(44)49-32-17-13-29(14-18-32)34(41)26-28-12-21-35(27(3)25-28)51-37(43)30-15-19-33(20-16-30)50-39(45)48-24-10-9-22-46-36(42)5-2/h4,12-21,25H,1,5-11,22-24,26H2,2-3H3 |
| InChIKey | ISGLTNXUXGQGEK-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.75 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|